2-methoxy-3,5-dinitrobenzonitrile structure
|
Common Name | 2-methoxy-3,5-dinitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 19019-04-6 | Molecular Weight | 223.14200 | |
| Density | 1.52g/cm3 | Boiling Point | 388.3ºC at 760mmHg | |
| Molecular Formula | C8H5N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | 2-methoxy-3,5-dinitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 388.3ºC at 760mmHg |
| Molecular Formula | C8H5N3O5 |
| Molecular Weight | 223.14200 |
| Flash Point | 188.6ºC |
| Exact Mass | 223.02300 |
| PSA | 124.66000 |
| LogP | 2.42968 |
| Vapour Pressure | 3.1E-06mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | BKJAXBDANXXYKI-UHFFFAOYSA-N |
| SMILES | COc1c(C#N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2926909090 |
|---|
|
~39%
2-methoxy-3,5-d... CAS#:19019-04-6 |
| Literature: Kawakami, Takehiko; Suzuki, Hitomi Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 8 p. 1259 - 1264 |
|
~%
2-methoxy-3,5-d... CAS#:19019-04-6 |
| Literature: Blanksma Chem. Zentralbl., 1908 , vol. 79, # II p. 1827 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(2-isocyanatoethyl)benzene |
| Methylaether-3.5-dinitro-salicylsaeure-nitril |
| 2-Cyan-4.6-dinitro-anisol |
| 2-methoxy-3,5-dinitro-benzonitrile |
| benzonitrile,2-methoxy-3,5-dinitro |
| 2-cyano-4,6-dinitroanisole |
| 2-Methoxy-3,5-dinitro-benzonitril |
| 2-Cyano-4,6-dinitro-anisol |