RI(dl)-2 structure
|
Common Name | RI(dl)-2 | ||
|---|---|---|---|---|
| CAS Number | 1902146-75-1 | Molecular Weight | 401.382 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RI(dl)-2RI(dl)-2 is a selective inhibitor of Rad51-mediated D-loop formation. |
| Name | RI(dl)-2 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18F3N3O2 |
|---|---|
| Molecular Weight | 401.382 |
| Exact Mass | 401.135101 |
| InChIKey | NIJZNZBFNNPMPH-UHFFFAOYSA-N |
| SMILES | CCNc1ccc(-c2nc3ccccc3n3cccc23)cc1.O=C(O)C(F)(F)F |
| RI(dl)-2 |
| Acetic acid, 2,2,2-trifluoro-, compd. with N-ethyl-4-pyrrolo[1,2-a]quinoxalin-4-ylbenzenamine (1:1) |
| N-Ethyl-4-(pyrrolo[1,2-a]quinoxalin-4-yl)aniline |
| N-Ethyl-4-(pyrrolo[1,2-a]quinoxalin-4-yl)aniline trifluoroacetate (1:1) |