acetic acid,pentadecan-8-ol
acetic acid,pentadecan-8-ol structure
|
Common Name | acetic acid,pentadecan-8-ol | ||
|---|---|---|---|---|
| CAS Number | 190249-59-3 | Molecular Weight | 288.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,pentadecan-8-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H36O3 |
|---|---|
| Molecular Weight | 288.46600 |
| Exact Mass | 288.26600 |
| PSA | 57.53000 |
| LogP | 5.15920 |
| InChIKey | VZHDMJCDIQJFAT-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CCCCCCCC(O)CCCCCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
acetic acid,pen... CAS#:190249-59-3 |
| Literature: Orita; Tanahashi; Kakuda; Otera Journal of Organic Chemistry, 2001 , vol. 66, # 26 p. 8926 - 8934 |
|
~%
acetic acid,pen... CAS#:190249-59-3 |
| Literature: Orita; Tanahashi; Kakuda; Otera Journal of Organic Chemistry, 2001 , vol. 66, # 26 p. 8926 - 8934 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetyl ester of 8-pentadecanol |
| 8-Pentadecanol,acetate |
| 8-Pentadecanol acetic acid ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of acetic acid,pentadecan-8-ol? |
| A: Molecular formula of acetic acid,pentadecan-8-ol is C17H36O3. |
| Q: What English synonyms does acetic acid,pentadecan-8-ol have? |
| A: English synonyms of acetic acid,pentadecan-8-ol: Acetyl ester of 8-pentadecanol, 8-Pentadecanol,acetate, 8-Pentadecanol acetic acid ester. |
| Q: What is the polar surface area (PSA) of acetic acid,pentadecan-8-ol? |
| A: Polar surface area (PSA) of acetic acid,pentadecan-8-ol is 57.53000. |
| Q: What is the InChIKey of acetic acid,pentadecan-8-ol? |
| A: InChIKey of acetic acid,pentadecan-8-ol is VZHDMJCDIQJFAT-UHFFFAOYSA-N. |
| Q: What is the English name of acetic acid,pentadecan-8-ol? |
| A: The English name of acetic acid,pentadecan-8-ol is acetic acid,pentadecan-8-ol. |
| Q: What is the CAS number of acetic acid,pentadecan-8-ol? |
| A: CAS number of acetic acid,pentadecan-8-ol is 190249-59-3. |
| Q: What is the LogP of acetic acid,pentadecan-8-ol? |
| A: LogP of acetic acid,pentadecan-8-ol is 5.15920. |
| Q: What is the SMILES notation of acetic acid,pentadecan-8-ol? |
| A: SMILES notation of acetic acid,pentadecan-8-ol is CC(=O)O.CCCCCCCC(O)CCCCCCC. |
| Q: What is the molecular weight of acetic acid,pentadecan-8-ol? |
| A: Molecular weight of acetic acid,pentadecan-8-ol is 288.46600. |
| Q: What is the Chinese name of 190249-59-3? |
| A: Chinese name of 190249-59-3 is 190249-59-3. |