2-Chloro-5-(1H-tetrazol-1-yl)benzoic acid structure
|
Common Name | 2-Chloro-5-(1H-tetrazol-1-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 190270-10-1 | Molecular Weight | 224.60400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Chloro-5-(1H-tetrazol-1-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5ClN4O2 |
|---|---|
| Molecular Weight | 224.60400 |
| Exact Mass | 224.01000 |
| PSA | 80.90000 |
| LogP | 1.01390 |
| InChIKey | VHQODBRTZLWSNM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-n2cnnn2)ccc1Cl |
| HS Code | 2933990090 |
|---|
|
~%
2-Chloro-5-(1H-... CAS#:190270-10-1 |
| Literature: Merck and Co., Inc. Patent: US5750549 A1, 1998 ; US 5750549 A |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dinitro-4-tert-butylchlorobenzene |
| 2,6-dinitro-4-t-butyl-1-chlorobenzene |
| 5-tert-butyl-2-chloro-1,3-dinitro-benzene |
| 2-CHLORO-5-(1,1-DIMETHYLETHYL)-1,3-DINITROBENZENE |
| 4-t-Butyl-2,6-dinitrochlorobenzene |
| 2,6-dinitro-4-tert-butylphenyl chloride |
| 2-chloro-5-tert-butyl-1,3-dinitrobenzene |
| 2-chloro-5-tetrazol-1-ylbenzoic acid |
| 2-chloro-5-(1-tetrazolyl)benzoic acid |
| 4-tert-Butyl-2,6-dinitrochlorobenzene |