9H-carbazole-1-carbaldehyde
9H-carbazole-1-carbaldehyde structure
|
Common Name | 9H-carbazole-1-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1903-94-2 | Molecular Weight | 195.21700 | |
| Density | 1.322±0.06 g/cm3(Predicted) | Boiling Point | 428.4±18.0 °C(Predicted) | |
| Molecular Formula | C13H9NO | Melting Point | 143 °C(Solv: ethanol (64-17-5)) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9H-carbazole-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.322±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 428.4±18.0 °C(Predicted) |
| Melting Point | 143 °C(Solv: ethanol (64-17-5)) |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.21700 |
| Exact Mass | 195.06800 |
| PSA | 32.86000 |
| LogP | 3.13360 |
| InChIKey | VMHCBSGWJYTOML-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc2c1[nH]c1ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9H-carbazole-1-... CAS#:1903-94-2 |
| Literature: Molina, Pedro; Fresneda, Pilar M.; Almendros, Pedro Tetrahedron, 1993 , vol. 49, # 6 p. 1223 - 1236 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:86-74-8
CAS#:6311-19-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| carbazole-1-carbaldehyde |
| 1-formylcarbazole |
| Carbazol-1-carbaldehyd |
| 1-Formylcarbazole |
| 1-Formylcarbazol |
| Carbazol-1-carboxaldehyd |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 9H-carbazole-1-carbaldehyde? |
| A: Related upstream materials(CAS) of 9H-carbazole-1-carbaldehyde: 108-94-1. |
| Q: What is the InChIKey of 9H-carbazole-1-carbaldehyde? |
| A: InChIKey of 9H-carbazole-1-carbaldehyde is VMHCBSGWJYTOML-UHFFFAOYSA-N. |
| Q: What is the melting point of 9H-carbazole-1-carbaldehyde? |
| A: Melting point of 9H-carbazole-1-carbaldehyde is 143 °C(Solv: ethanol (64-17-5)). |
| Q: What is the boiling point of 9H-carbazole-1-carbaldehyde? |
| A: Boiling point of 9H-carbazole-1-carbaldehyde is 428.4±18.0 °C(Predicted). |
| Q: What is the CAS number of 9H-carbazole-1-carbaldehyde? |
| A: CAS number of 9H-carbazole-1-carbaldehyde is 1903-94-2. |
| Q: What is the LogP of 9H-carbazole-1-carbaldehyde? |
| A: LogP of 9H-carbazole-1-carbaldehyde is 3.13360. |
| Q: What is the molecular weight of 9H-carbazole-1-carbaldehyde? |
| A: Molecular weight of 9H-carbazole-1-carbaldehyde is 195.21700. |
| Q: What is the English name of 9H-carbazole-1-carbaldehyde? |
| A: The English name of 9H-carbazole-1-carbaldehyde is 9H-carbazole-1-carbaldehyde. |
| Q: What is the SMILES notation of 9H-carbazole-1-carbaldehyde? |
| A: SMILES notation of 9H-carbazole-1-carbaldehyde is O=Cc1cccc2c1[nH]c1ccccc12. |
| Q: What are the downstream products of 9H-carbazole-1-carbaldehyde? |
| A: Related downstream products(CAS) of 9H-carbazole-1-carbaldehyde: 86-74-8;6311-19-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |