(5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal
![(5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal Structure](https://image.chemsrc.com/caspic/454/190369-75-6.png)
(5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal structure
|
Common Name | (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal | ||
|---|---|---|---|---|
| CAS Number | 190369-75-6 | Molecular Weight | 244.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H28O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H28O2Si |
|---|---|
| Molecular Weight | 244.44600 |
| Exact Mass | 244.18600 |
| PSA | 26.30000 |
| LogP | 4.01350 |
| InChIKey | IJNWYKXQYLOSGQ-LBPRGKRZSA-N |
| SMILES | CC(CCCC=O)CO[Si](C)(C)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hexanal,6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-5-methyl-,(5S) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: LogP of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is 4.01350. |
| Q: What is the SMILES notation of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: SMILES notation of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is CC(CCCC=O)CO[Si](C)(C)C(C)(C)C. |
| Q: What is the molecular formula of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: Molecular formula of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is C13H28O2Si. |
| Q: What is the polar surface area (PSA) of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: Polar surface area (PSA) of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is 26.30000. |
| Q: What is the molecular weight of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: Molecular weight of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is 244.44600. |
| Q: What is the Chinese name of 190369-75-6? |
| A: Chinese name of 190369-75-6 is 190369-75-6. |
| Q: What is the CAS number of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: CAS number of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is 190369-75-6. |
| Q: What is the English name of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: The English name of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal. |
| Q: What is the InChIKey of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal? |
| A: InChIKey of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal is IJNWYKXQYLOSGQ-LBPRGKRZSA-N. |
| Q: What English synonyms does (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal have? |
| A: English synonyms of (5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanal: Hexanal,6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-5-methyl-,(5S). |