1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid structure
|
Common Name | 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1904360-75-3 | Molecular Weight | 224.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9FO4 |
|---|---|
| Molecular Weight | 224.18 |
| InChIKey | OVROISFCZURZRU-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC1(C(=O)O)c1ccccc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: InChIKey of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid is OVROISFCZURZRU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1904360-75-3? |
| A: Chinese name of 1904360-75-3 is 1904360-75-3. |
| Q: What is the molecular formula of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: Molecular formula of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid is C11H9FO4. |
| Q: What is the molecular weight of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: Molecular weight of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 224.18. |
| Q: What is the English name of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: The English name of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid. |
| Q: What is the CAS number of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: CAS number of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 1904360-75-3. |
| Q: What is the SMILES notation of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: SMILES notation of 1-(2-Fluorophenyl)cyclopropane-1,2-dicarboxylic acid is O=C(O)C1CC1(C(=O)O)c1ccccc1F. |