dbs structure
|
Common Name | dbs | ||
|---|---|---|---|---|
| CAS Number | 19046-64-1 | Molecular Weight | 358.38500 | |
| Density | 1.272g/cm3 | Boiling Point | 565.2ºC at 760 mmHg | |
| Molecular Formula | C20H22O6 | Melting Point | 224-228ºC | |
| MSDS | N/A | Flash Point | 295.6ºC | |
| Name | (1,3:2,4) dibenzylidene sorbitol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 565.2ºC at 760 mmHg |
| Melting Point | 224-228ºC |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.38500 |
| Flash Point | 295.6ºC |
| Exact Mass | 358.14200 |
| PSA | 77.38000 |
| LogP | 1.93660 |
| Vapour Pressure | 1.31E-13mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | FMZUHGYZWYNSOA-VVBFYGJXSA-N |
| SMILES | OCC(O)C1OC(c2ccccc2)OC2COC(c3ccccc3)OC21 |
|
~74%
dbs CAS#:19046-64-1 |
| Literature: Bieg, Tadeusz; Szeja, Wieslaw Carbohydrate Research, 1985 , vol. 140, p. C7 - C8 |
|
~%
dbs CAS#:19046-64-1 |
| Literature: Wolfe; Hann; Hudson Journal of the American Chemical Society, 1942 , vol. 64, p. 1494 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| DBS |
| 1,3:2,4-di-O-benzylidene-D-sorbitol |
| 1,3:2,4-di-O-benzylidene-D-glucitol |
| 1.3,2.4-dibenzylidene-d-sorbitol |
| 1-O,3-O:2-O,4-O-Dibenzylidene-D-sorbitol |
| 1-O,3-O:2-O,4-O-Dibenzylidene-D-glucitol |