2,3,5,6-tetrachloro-4-propylsulfanylpyridine structure
|
Common Name | 2,3,5,6-tetrachloro-4-propylsulfanylpyridine | ||
|---|---|---|---|---|
| CAS Number | 19050-48-7 | Molecular Weight | 291.02500 | |
| Density | 1.52g/cm3 | Boiling Point | 322ºC at 760mmHg | |
| Molecular Formula | C8H7Cl4NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5ºC | |
| Name | 2,3,5,6-tetrachloro-4-propylsulfanylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 322ºC at 760mmHg |
| Molecular Formula | C8H7Cl4NS |
| Molecular Weight | 291.02500 |
| Flash Point | 148.5ºC |
| Exact Mass | 288.90500 |
| PSA | 38.19000 |
| LogP | 5.19730 |
| Vapour Pressure | 0.000541mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | SFZLAIOIVCOPBG-UHFFFAOYSA-N |
| SMILES | CCCSc1c(Cl)c(Cl)nc(Cl)c1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,5,6-tetrachloro-4-(n-propylthio)-pyridine |
| EINECS 242-787-5 |
| Propyl-2,3,5,6-tetrachlor-4-pyridyl-sulfid |
| 2,3,5,6-Tetrachloro-4-(propylthio)pyridine |
| Pyridine,2,3,5,6-tetrachloro-4-(propylthio) |