(Z)-2-(2-nitrophenyl)-3-phenyl-prop-2-enenitrile structure
|
Common Name | (Z)-2-(2-nitrophenyl)-3-phenyl-prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 19051-30-0 | Molecular Weight | 250.25200 | |
| Density | 1.265g/cm3 | Boiling Point | 413.4ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8ºC | |
| Name | (Z)-2-(2-nitrophenyl)-3-phenylprop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 413.4ºC at 760 mmHg |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.25200 |
| Flash Point | 203.8ºC |
| Exact Mass | 250.07400 |
| PSA | 69.61000 |
| LogP | 4.18218 |
| Vapour Pressure | 4.81E-07mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | QPOKESDOJWYPOO-JLHYYAGUSA-N |
| SMILES | N#CC(=Cc1ccccc1)c1ccccc1[N+](=O)[O-] |
|
~%
(Z)-2-(2-nitrop... CAS#:19051-30-0 |
| Literature: Coutts; Mukherjee; Abramovitch; Brewster Journal of the Chemical Society. Perkin transactions 1, 1969 , vol. 16, p. 2207 - 2212 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(2-(Hydroxy(oxido)amino)phenyl)-3-phenylacrylonitrile |
| 2-<2-Nitro-phenyl>-zimtsaeure-nitril |