2-Amino-4-methyl-6-tert-butylphenol structure
|
Common Name | 2-Amino-4-methyl-6-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 19059-89-3 | Molecular Weight | 179.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-6-tert-butyl-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17NO |
|---|---|
| Molecular Weight | 179.25900 |
| Exact Mass | 179.13100 |
| PSA | 46.25000 |
| LogP | 3.16150 |
| InChIKey | QUFHKFVBPSAABK-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c(O)c(C(C)(C)C)c1 |
| HS Code | 2922299090 |
|---|
|
~%
2-Amino-4-methy... CAS#:19059-89-3 |
| Literature: Albert Journal of the American Chemical Society, 1954 , vol. 76, p. 4983 |
|
~%
2-Amino-4-methy... CAS#:19059-89-3 |
| Literature: Albert Journal of the American Chemical Society, 1954 , vol. 76, p. 4983 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phenol,2-amino-6-(1,1-dimethylethyl)-4-methyl |
| p-Cresol,2-amino-6-tert-butyl |
| 2-Amino-4-methyl-6-tert.-butyl-phenol |
| 2-Amino-6-tert-butyl-4-methyl-phenol |