CGP-74514A structure
|
Common Name | CGP-74514A | ||
|---|---|---|---|---|
| CAS Number | 190653-73-7 | Molecular Weight | 385.89400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24ClN7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CGP-74514AA potent, dual CDC-like kinase (CLK)/CDK inhibitor with IC50 of 148, 111, 104, 382 and 573 nM for CLK1, CLK2, CLK4, CDK1 and CDK4, respectively.. |
| Name | 2-N-[(1R,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-ethylpurine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24ClN7 |
|---|---|
| Molecular Weight | 385.89400 |
| Exact Mass | 385.17800 |
| PSA | 96.91000 |
| LogP | 4.12020 |
| InChIKey | UTBSBSOBZHXMHI-LSDHHAIUSA-N |
| SMILES | CCn1cnc2c(Nc3cccc(Cl)c3)nc(NC3CCCCC3N)nc21 |
| UNII-7LQ52UF48A |
| N-(cis-2-Aminocyclohexyl)-N-(3-chlorophenyl)-9-ethyl-9H-purine-2,6-diamine |
| CGP-74514A |