2,4-bis(bromomethyl)-1,3,5-triethylbenzene structure
|
Common Name | 2,4-bis(bromomethyl)-1,3,5-triethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 190779-61-4 | Molecular Weight | 348.11700 | |
| Density | 1.41g/cm3 | Boiling Point | 342.5ºC at 760 mmHg | |
| Molecular Formula | C14H20Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | 2,4-bis(bromomethyl)-1,3,5-triethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 342.5ºC at 760 mmHg |
| Molecular Formula | C14H20Br2 |
| Molecular Weight | 348.11700 |
| Flash Point | 187.2ºC |
| Exact Mass | 345.99300 |
| LogP | 5.16360 |
| Vapour Pressure | 0.000149mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | HPICIYNHRQVDCM-UHFFFAOYSA-N |
| SMILES | CCc1cc(CC)c(CBr)c(CC)c1CBr |
|
~%
2,4-bis(bromome... CAS#:190779-61-4 |
| Literature: Capitan-Vallvey, Luis Fermin; Arroyo-Guerrero, Eduardo; Fernandez-Ramos, Maria Dolores; Santoyo-Gonzalez Analytical Chemistry, 2005 , vol. 77, # 14 p. 4459 - 4466 |
|
~%
2,4-bis(bromome... CAS#:190779-61-4 |
| Literature: Voo; Lam; Rheingold; Riordan Journal of the Chemical Society, Dalton Transactions, 2001 , # 12 p. 1803 - 1805 |
| 2,4-bis-bromomethyl-1,3,5-triethyl-benzene |
| BEN088 |