ethyl (4-bromo-3-chlorophenyl)carbamothioylsulfanylformate structure
|
Common Name | ethyl (4-bromo-3-chlorophenyl)carbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 19079-22-2 | Molecular Weight | 354.67100 | |
| Density | 1.697g/cm3 | Boiling Point | 410.2ºC at 760 mmHg | |
| Molecular Formula | C10H9BrClNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | ethyl (4-bromo-3-chlorophenyl)carbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.697g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760 mmHg |
| Molecular Formula | C10H9BrClNO2S2 |
| Molecular Weight | 354.67100 |
| Flash Point | 201.9ºC |
| Exact Mass | 352.89500 |
| PSA | 102.76000 |
| LogP | 4.90950 |
| Vapour Pressure | 6.13E-07mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | DQOXVAVYIZXXGV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)Nc1ccc(Br)c(Cl)c1 |
| Carbonic acid,thio-,anhydrosulfide with 4-bromo-3-chlorodithiocarbanilic acid,ethyl ester |
| Thiocarbonic acid anhydrosulfide with 4-bromo-3-chlorodithiocarbanilic acid ethyl ester |