acetic acid,2,4,6-trimethylphenol
acetic acid,2,4,6-trimethylphenol structure
|
Common Name | acetic acid,2,4,6-trimethylphenol | ||
|---|---|---|---|---|
| CAS Number | 19082-49-6 | Molecular Weight | 196.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,2,4,6-trimethylphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16O3 |
|---|---|
| Molecular Weight | 196.24300 |
| Exact Mass | 196.11000 |
| PSA | 57.53000 |
| LogP | 2.40830 |
| InChIKey | UQWGYFXOPOJLOQ-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Cc1cc(C)c(O)c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phenol,2,4,6-trimethyl-,acetate |
| Essigsaeure-mesitylester |
| 2,4,6-trimethylphenyl acetate |
| acetic acid mesityl ester |
| (2.4.6-Trimethyl-phenyl)-acetat |
| Essigsaeure-(2.4.6-trimethyl-phenylester) |
| mesityl acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 19082-49-6? |
| A: Chinese name of 19082-49-6 is 19082-49-6. |
| Q: What is the LogP of acetic acid,2,4,6-trimethylphenol? |
| A: LogP of acetic acid,2,4,6-trimethylphenol is 2.40830. |
| Q: What is the molecular weight of acetic acid,2,4,6-trimethylphenol? |
| A: Molecular weight of acetic acid,2,4,6-trimethylphenol is 196.24300. |
| Q: What is the English name of acetic acid,2,4,6-trimethylphenol? |
| A: The English name of acetic acid,2,4,6-trimethylphenol is acetic acid,2,4,6-trimethylphenol. |
| Q: What is the InChIKey of acetic acid,2,4,6-trimethylphenol? |
| A: InChIKey of acetic acid,2,4,6-trimethylphenol is UQWGYFXOPOJLOQ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of acetic acid,2,4,6-trimethylphenol? |
| A: Polar surface area (PSA) of acetic acid,2,4,6-trimethylphenol is 57.53000. |
| Q: What is the CAS number of acetic acid,2,4,6-trimethylphenol? |
| A: CAS number of acetic acid,2,4,6-trimethylphenol is 19082-49-6. |
| Q: What is the SMILES notation of acetic acid,2,4,6-trimethylphenol? |
| A: SMILES notation of acetic acid,2,4,6-trimethylphenol is CC(=O)O.Cc1cc(C)c(O)c(C)c1. |
| Q: What is the molecular formula of acetic acid,2,4,6-trimethylphenol? |
| A: Molecular formula of acetic acid,2,4,6-trimethylphenol is C11H16O3. |
| Q: What English synonyms does acetic acid,2,4,6-trimethylphenol have? |
| A: English synonyms of acetic acid,2,4,6-trimethylphenol: Phenol,2,4,6-trimethyl-,acetate, Essigsaeure-mesitylester, 2,4,6-trimethylphenyl acetate, acetic acid mesityl ester, (2.4.6-Trimethyl-phenyl)-acetat, Essigsaeure-(2.4.6-trimethyl-phenylester), mesityl acetate. |