1,1-Binaphthalene-2,2-dithiol, 3,3-dimethyl
1,1-Binaphthalene-2,2-dithiol, 3,3-dimethyl structure
|
Common Name | 1,1-Binaphthalene-2,2-dithiol, 3,3-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 190841-68-0 | Molecular Weight | 346.50800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H18S2 |
|---|---|
| Molecular Weight | 346.50800 |
| Exact Mass | 346.08500 |
| PSA | 77.60000 |
| LogP | 6.85420 |
| InChIKey | YLWGGSVDHYBPKK-UHFFFAOYSA-N |
| SMILES | Cc1cc2ccccc2c(-c2c(S)c(C)cc3ccccc23)c1S |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
1,1-Binaphthale... CAS#:190841-68-0 |
| Literature: Cossu, Sergio; De Lucchi, Ottorino; Fabbri, Davide; Valle, Giovanni; Painter, Gavin F.; Smith, Robin A.J. Tetrahedron, 1997 , vol. 53, # 17 p. 6073 - 6084 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-Binaphthalene-2,2-dithiol,3,3-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: Molecular weight of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is 346.50800. |
| Q: What is the InChIKey of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: InChIKey of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is YLWGGSVDHYBPKK-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: Polar surface area (PSA) of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is 77.60000. |
| Q: What is the English name of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: The English name of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol. |
| Q: What is the molecular formula of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: Molecular formula of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is C22H18S2. |
| Q: What is the LogP of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: LogP of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is 6.85420. |
| Q: What is the Chinese name of 190841-68-0? |
| A: Chinese name of 190841-68-0 is 190841-68-0. |
| Q: What is the SMILES notation of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: SMILES notation of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is Cc1cc2ccccc2c(-c2c(S)c(C)cc3ccccc23)c1S. |
| Q: What English synonyms does 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol have? |
| A: English synonyms of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol: 1,1-Binaphthalene-2,2-dithiol,3,3-dimethyl. |
| Q: What is the CAS number of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol? |
| A: CAS number of 3-methyl-1-(3-methyl-2-sulfanylnaphthalen-1-yl)naphthalene-2-thiol is 190841-68-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |