2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid
Modify Date: 2026-07-06 11:15:19
![2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid Structure](https://www.chemsrc.com/extcaspic/422/190844-97-4.png)
2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid structure
|
Common Name | 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 190844-97-4 | Molecular Weight | 285.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO4 |
|---|---|
| Molecular Weight | 285.29 |
| InChIKey | SWCHNXWMKCJVRX-UHFFFAOYSA-N |
| SMILES | CCc1ccc(Nc2c(C(=O)O)cccc2C(=O)O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid? |
| A: InChIKey of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid is SWCHNXWMKCJVRX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid? |
| A: Molecular formula of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid is C16H15NO4. |
| Q: What is the English name of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid? |
| A: The English name of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid is 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid. |
| Q: What is the CAS number of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid? |
| A: CAS number of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid is 190844-97-4. |
| Q: What is the molecular weight of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid? |
| A: Molecular weight of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid is 285.29. |
| Q: What is the SMILES notation of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid? |
| A: SMILES notation of 2-[(4-Ethylphenyl)amino]-1,3-benzenedicarboxylic acid is CCc1ccc(Nc2c(C(=O)O)cccc2C(=O)O)cc1. |
| Q: What is the Chinese name of 190844-97-4? |
| A: Chinese name of 190844-97-4 is 190844-97-4. |