7-ethylacridine-4-carboxylic Acid
Modify Date: 2026-09-26 18:57:46
7-ethylacridine-4-carboxylic Acid structure
|
Common Name | 7-ethylacridine-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 190844-99-6 | Molecular Weight | 251.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-ethylacridine-4-carboxylic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13NO2 |
|---|---|
| Molecular Weight | 251.28 |
| InChIKey | ZHCAUZDPKQBYPY-UHFFFAOYSA-N |
| SMILES | CCc1ccc2nc3c(C(=O)O)cccc3cc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-ethylacridine-4-carboxylic Acid? |
| A: Molecular formula of 7-ethylacridine-4-carboxylic Acid is C16H13NO2. |
| Q: What is the English name of 7-ethylacridine-4-carboxylic Acid? |
| A: The English name of 7-ethylacridine-4-carboxylic Acid is 7-ethylacridine-4-carboxylic Acid. |
| Q: What is the InChIKey of 7-ethylacridine-4-carboxylic Acid? |
| A: InChIKey of 7-ethylacridine-4-carboxylic Acid is ZHCAUZDPKQBYPY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 7-ethylacridine-4-carboxylic Acid? |
| A: SMILES notation of 7-ethylacridine-4-carboxylic Acid is CCc1ccc2nc3c(C(=O)O)cccc3cc2c1. |
| Q: What is the CAS number of 7-ethylacridine-4-carboxylic Acid? |
| A: CAS number of 7-ethylacridine-4-carboxylic Acid is 190844-99-6. |
| Q: What is the molecular weight of 7-ethylacridine-4-carboxylic Acid? |
| A: Molecular weight of 7-ethylacridine-4-carboxylic Acid is 251.28. |
| Q: What is the Chinese name of 190844-99-6? |
| A: Chinese name of 190844-99-6 is 190844-99-6. |