7-tert-butylacridine-4-carboxylic Acid
Modify Date: 2025-10-10 14:46:42
7-tert-butylacridine-4-carboxylic Acid structure
|
Common Name | 7-tert-butylacridine-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 190845-16-0 | Molecular Weight | 279.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-tert-butylacridine-4-carboxylic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17NO2 |
|---|---|
| Molecular Weight | 279.3 |
| InChIKey | MGYIJFBRIAMZQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2nc3c(C(=O)O)cccc3cc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 7-tert-butylacridine-4-carboxylic Acid? |
| A: InChIKey of 7-tert-butylacridine-4-carboxylic Acid is MGYIJFBRIAMZQP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 7-tert-butylacridine-4-carboxylic Acid? |
| A: SMILES notation of 7-tert-butylacridine-4-carboxylic Acid is CC(C)(C)c1ccc2nc3c(C(=O)O)cccc3cc2c1. |
| Q: What is the Chinese name of 190845-16-0? |
| A: Chinese name of 190845-16-0 is 190845-16-0. |
| Q: What is the CAS number of 7-tert-butylacridine-4-carboxylic Acid? |
| A: CAS number of 7-tert-butylacridine-4-carboxylic Acid is 190845-16-0. |
| Q: What is the molecular formula of 7-tert-butylacridine-4-carboxylic Acid? |
| A: Molecular formula of 7-tert-butylacridine-4-carboxylic Acid is C18H17NO2. |
| Q: What is the molecular weight of 7-tert-butylacridine-4-carboxylic Acid? |
| A: Molecular weight of 7-tert-butylacridine-4-carboxylic Acid is 279.3. |
| Q: What is the English name of 7-tert-butylacridine-4-carboxylic Acid? |
| A: The English name of 7-tert-butylacridine-4-carboxylic Acid is 7-tert-butylacridine-4-carboxylic Acid. |