Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate
Modify Date: 2026-07-23 10:28:07
Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate structure
|
Common Name | Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1908452-29-8 | Molecular Weight | 336.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24N2O2 |
|---|---|
| Molecular Weight | 336.4 |
| InChIKey | YSCZTOVVQMAAKL-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1CCC(c2ccccc2)=NN1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate? |
| A: Molecular formula of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate is C21H24N2O2. |
| Q: What is the CAS number of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate? |
| A: CAS number of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate is 1908452-29-8. |
| Q: What is the SMILES notation of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate? |
| A: SMILES notation of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate is CCCCOC(=O)C1CCC(c2ccccc2)=NN1c1ccccc1. |
| Q: What is the InChIKey of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate? |
| A: InChIKey of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate is YSCZTOVVQMAAKL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate? |
| A: Molecular weight of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate is 336.4. |
| Q: What is the English name of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate? |
| A: The English name of Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate is Butyl 2,6-diphenyl-2,3,4,5-tetrahydropyridazine-3-carboxylate. |
| Q: What is the Chinese name of 1908452-29-8? |
| A: Chinese name of 1908452-29-8 is 1908452-29-8. |