dichlorophosphorylimino(triphenyl)-λ5-phosphane
dichlorophosphorylimino(triphenyl)-λ5-phosphane structure
|
Common Name | dichlorophosphorylimino(triphenyl)-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 19085-97-3 | Molecular Weight | 394.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15Cl2NOP2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dichlorophosphorylimino(triphenyl)-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H15Cl2NOP2 |
|---|---|
| Molecular Weight | 394.17100 |
| Exact Mass | 393.00100 |
| PSA | 49.05000 |
| LogP | 5.74980 |
| InChIKey | LQUNUCXYAXADEJ-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(Cl)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~73%
dichlorophospho... CAS#:19085-97-3 |
| Literature: Rahier, Nicolas J.; Volle, Jean-Noel; Lacour, Marie Agnes; Taillefer, Marc Tetrahedron, 2008 , vol. 64, # 28 p. 6645 - 6650 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Triphenylphosphinimin-dichlorphosphat |
| Phosphoramidic dichloride,(triphenylphosphoranylidene) |
| triphenylphosphazo-N-dichlorophosphonyl |
| Triphenylphosphinium-dichlorphosphat |
| N-(dichlorophosphinyl)-P,P,P-triphenylphosphine imide |
| triphenylphosphazodichlorophosphine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: Molecular weight of dichlorophosphorylimino(triphenyl)-λ5-phosphane is 394.17100. |
| Q: What is the SMILES notation of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: SMILES notation of dichlorophosphorylimino(triphenyl)-λ5-phosphane is O=P(Cl)(Cl)N=P(c1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the LogP of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: LogP of dichlorophosphorylimino(triphenyl)-λ5-phosphane is 5.74980. |
| Q: What is the English name of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: The English name of dichlorophosphorylimino(triphenyl)-λ5-phosphane is dichlorophosphorylimino(triphenyl)-λ5-phosphane. |
| Q: What is the InChIKey of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: InChIKey of dichlorophosphorylimino(triphenyl)-λ5-phosphane is LQUNUCXYAXADEJ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: Polar surface area (PSA) of dichlorophosphorylimino(triphenyl)-λ5-phosphane is 49.05000. |
| Q: What is the CAS number of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: CAS number of dichlorophosphorylimino(triphenyl)-λ5-phosphane is 19085-97-3. |
| Q: What is the Chinese name of 19085-97-3? |
| A: Chinese name of 19085-97-3 is 19085-97-3. |
| Q: What English synonyms does dichlorophosphorylimino(triphenyl)-λ5-phosphane have? |
| A: English synonyms of dichlorophosphorylimino(triphenyl)-λ5-phosphane: Triphenylphosphinimin-dichlorphosphat, Phosphoramidic dichloride,(triphenylphosphoranylidene), triphenylphosphazo-N-dichlorophosphonyl, Triphenylphosphinium-dichlorphosphat, N-(dichlorophosphinyl)-P,P,P-triphenylphosphine imide, triphenylphosphazodichlorophosphine. |
| Q: What is the molecular formula of dichlorophosphorylimino(triphenyl)-λ5-phosphane? |
| A: Molecular formula of dichlorophosphorylimino(triphenyl)-λ5-phosphane is C18H15Cl2NOP2. |