Arabinooctaose
Modify Date: 2026-09-28 14:34:16
Arabinooctaose structure
|
Common Name | Arabinooctaose | ||
|---|---|---|---|---|
| CAS Number | 190852-28-9 | Molecular Weight | 1074.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H66O33 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Arabinooctaose |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C40H66O33 |
|---|---|
| Molecular Weight | 1074.9 |
| InChIKey | WOKPDOVLMQKECH-GXESVQKASA-N |
| SMILES | OCC1OC(OCC2OC(OCC3OC(OCC4OC(OCC5OC(OCC6OC(OCC7OC(OCC8OC(O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O)C(O)C2O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Arabinooctaose? |
| A: InChIKey of Arabinooctaose is WOKPDOVLMQKECH-GXESVQKASA-N. |
| Q: What is the molecular weight of Arabinooctaose? |
| A: Molecular weight of Arabinooctaose is 1074.9. |
| Q: What is the CAS number of Arabinooctaose? |
| A: CAS number of Arabinooctaose is 190852-28-9. |
| Q: What is the molecular formula of Arabinooctaose? |
| A: Molecular formula of Arabinooctaose is C40H66O33. |
| Q: What is the English name of Arabinooctaose? |
| A: The English name of Arabinooctaose is Arabinooctaose. |
| Q: What is the SMILES notation of Arabinooctaose? |
| A: SMILES notation of Arabinooctaose is OCC1OC(OCC2OC(OCC3OC(OCC4OC(OCC5OC(OCC6OC(OCC7OC(OCC8OC(O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O)C(O)C2O)C(O)C1O. |
| Q: What is the Chinese name of 190852-28-9? |
| A: Chinese name of 190852-28-9 is 190852-28-9. |