Anserinone B
Anserinone B structure
|
Common Name | Anserinone B | ||
|---|---|---|---|---|
| CAS Number | 190895-96-6 | Molecular Weight | 210.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Anserinone BAnserinone B is an antifungal and antibacterial benzoquinone. Anserinone B causes radial growth reductions of 50% and 37% against S.fimicola and A. furfuraceus, respectively. Anserinones B also displays moderate cytotoxicity in the NCI’s 60 human tumor cell line panel (GI50=4.4 µg/mL)[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Anserinone B |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Anserinone B is an antifungal and antibacterial benzoquinone. Anserinone B causes radial growth reductions of 50% and 37% against S.fimicola and A. furfuraceus, respectively. Anserinones B also displays moderate cytotoxicity in the NCI’s 60 human tumor cell line panel (GI50=4.4 µg/mL)[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14O4 |
|---|---|
| Molecular Weight | 210.23 |
| InChIKey | UDHYZSNFKHIRSC-ZCFIWIBFSA-N |
| SMILES | COC1=CC(=O)C(C)=C(CC(C)O)C1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Anserinone B? |
| A: InChIKey of Anserinone B is UDHYZSNFKHIRSC-ZCFIWIBFSA-N. |
| Q: What is the molecular formula of Anserinone B? |
| A: Molecular formula of Anserinone B is C11H14O4. |
| Q: What are the uses of Anserinone B? |
| A: Main uses of Anserinone B: Anserinone B is an antifungal and antibacterial benzoquinone. Anserinone B causes radial growth reductions of 50% and 37% against S.fimicola and A. furfuraceus, respectively. Anserinones B also displays moderate cytotoxicity in the NCI’s 60 human tumor cell line panel (GI50=4.4 µg/mL)[1]. |
| Q: What is the CAS number of Anserinone B? |
| A: CAS number of Anserinone B is 190895-96-6. |
| Q: What is the English name of Anserinone B? |
| A: The English name of Anserinone B is Anserinone B. |
| Q: What is the SMILES notation of Anserinone B? |
| A: SMILES notation of Anserinone B is COC1=CC(=O)C(C)=C(CC(C)O)C1=O. |
| Q: What is the molecular weight of Anserinone B? |
| A: Molecular weight of Anserinone B is 210.23. |
| Q: What is the Chinese name of 190895-96-6? |
| A: Chinese name of 190895-96-6 is 190895-96-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |