Thuggacin A
Modify Date: 2026-06-28 07:12:08
Thuggacin A structure
|
Common Name | Thuggacin A | ||
|---|---|---|---|---|
| CAS Number | 190895-98-8 | Molecular Weight | 631.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H53NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Thuggacin A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C35H53NO7S |
|---|---|
| Molecular Weight | 631.9 |
| InChIKey | CGUNOWXWUXNOPE-IZQHEKLCSA-N |
| SMILES | CCCCCC/C/1=C\C2=CSC(=N2)[C@H]([C@@H](C[C@H](/C=C/C=C\C[C@@H](OC1=O)[C@@H]([C@H](C(C)C(/C(=C/C(=C/C)/C)/C)O)O)O)O)O)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antimycobacterial activity against Mycobacterium tuberculosis H37Rv
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL2209271
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Thuggacin A? |
| A: Molecular weight of Thuggacin A is 631.9. |
| Q: What is the InChIKey of Thuggacin A? |
| A: InChIKey of Thuggacin A is CGUNOWXWUXNOPE-IZQHEKLCSA-N. |
| Q: What is the English name of Thuggacin A? |
| A: The English name of Thuggacin A is Thuggacin A. |
| Q: What is the molecular formula of Thuggacin A? |
| A: Molecular formula of Thuggacin A is C35H53NO7S. |
| Q: What is the Chinese name of 190895-98-8? |
| A: Chinese name of 190895-98-8 is 190895-98-8. |
| Q: What is the SMILES notation of Thuggacin A? |
| A: SMILES notation of Thuggacin A is CCCCCC/C/1=C\C2=CSC(=N2)[C@H]([C@@H](C[C@H](/C=C/C=C\C[C@@H](OC1=O)[C@@H]([C@H](C(C)C(/C(=C/C(=C/C)/C)/C)O)O)O)O)O)C. |
| Q: What is the CAS number of Thuggacin A? |
| A: CAS number of Thuggacin A is 190895-98-8. |