Isocupressic acid structure
|
Common Name | Isocupressic acid | ||
|---|---|---|---|---|
| CAS Number | 1909-91-7 | Molecular Weight | 320.466 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 454.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.6±23.3 °C | |
Use of Isocupressic acidIsocupressic acid ((+)-Isocupressic acid) is an abortifacient compound[1]. |
| Name | (1S,4aR,5S,8aR)-5-[(E)-5-hydroxy-3-methylpent-3-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Isocupressic acid ((+)-Isocupressic acid) is an abortifacient compound[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Isocupressic acid (1-1000 ng/mL; 4 h) inhibits basal and ovine luteinizing hormone (oLH) stimulating secretion of progesterone in bovine luteal cells without cell death[1]. Isocupressic acid inhibits progesterone production by blocking oLH and cAMP actions at the cellular level of luteal cells[1]. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 454.2±38.0 °C at 760 mmHg |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.466 |
| Flash Point | 242.6±23.3 °C |
| Exact Mass | 320.235138 |
| PSA | 57.53000 |
| LogP | 5.51 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | DOYKMKZYLAAOGH-DOEMEAPXSA-N |
| SMILES | C=C1CCC2C(C)(C(=O)O)CCCC2(C)C1CCC(C)=CCO |
| 15-hydroxyisolongifolane |
| (1S,4aR,5S,8aR)-5-[(3E)-5-Hydroxy-3-methyl-3-penten-1-yl]-1,4a-dimethyl-6-methylenedecahydro-1-naphthalenecarboxylic acid |
| Isocupressic acid |
| 3-isolongifolol |