N-(3,3-Dimethylbutyl)-L-α-aspartyl-L-phenylalanine structure
|
Common Name | N-(3,3-Dimethylbutyl)-L-α-aspartyl-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 190910-14-6 | Molecular Weight | 364.436 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 605.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.0±31.5 °C | |
| Name | K3TTN372MU |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 605.5±55.0 °C at 760 mmHg |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.436 |
| Flash Point | 320.0±31.5 °C |
| Exact Mass | 364.199829 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | YHHAZJVJJCTGLB-GJZGRUSLSA-N |
| SMILES | CC(C)(C)CCNC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
| K3TTN372MU |
| Phenylalanine, N-(3,3-dimethylbutyl)-L-α-aspartyl- |
| N-(3,3-dimethylbutyl)-L--aspartyl-L-phenylalanine |
| N-(3,3-Dimethylbutyl)-L-α-aspartylphenylalanine |