2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride
Modify Date: 2025-09-02 11:52:57
2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride structure
|
Common Name | 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1909317-56-1 | Molecular Weight | 237.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7Cl3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H7Cl3O2S |
|---|---|
| Molecular Weight | 237.5 |
| InChIKey | CKLNRBHTGMOPCQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CCC1CC1(Cl)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride? |
| A: SMILES notation of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride is O=S(=O)(Cl)CCC1CC1(Cl)Cl. |
| Q: What is the molecular formula of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride? |
| A: Molecular formula of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride is C5H7Cl3O2S. |
| Q: What is the Chinese name of 1909317-56-1? |
| A: Chinese name of 1909317-56-1 is 1909317-56-1. |
| Q: What is the InChIKey of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride? |
| A: InChIKey of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride is CKLNRBHTGMOPCQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride? |
| A: CAS number of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride is 1909317-56-1. |
| Q: What is the English name of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride? |
| A: The English name of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride is 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride. |
| Q: What is the molecular weight of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride? |
| A: Molecular weight of 2-(2,2-Dichlorocyclopropyl)ethane-1-sulfonyl chloride is 237.5. |