1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid
Modify Date: 2025-08-23 19:46:57
![1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/118/1909337-75-2.png)
1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid structure
|
Common Name | 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1909337-75-2 | Molecular Weight | 211.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13N3O3 |
|---|---|
| Molecular Weight | 211.22 |
| InChIKey | JHVNFFKXOIZRBL-UHFFFAOYSA-N |
| SMILES | CCC1(Cn2cc(C(=O)O)nn2)COC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid? |
| A: InChIKey of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid is JHVNFFKXOIZRBL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1909337-75-2? |
| A: Chinese name of 1909337-75-2 is 1909337-75-2. |
| Q: What is the CAS number of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid? |
| A: CAS number of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid is 1909337-75-2. |
| Q: What is the English name of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid? |
| A: The English name of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid is 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid. |
| Q: What is the molecular formula of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid? |
| A: Molecular formula of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid is C9H13N3O3. |
| Q: What is the SMILES notation of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid? |
| A: SMILES notation of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid is CCC1(Cn2cc(C(=O)O)nn2)COC1. |
| Q: What is the molecular weight of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid? |
| A: Molecular weight of 1-[(3-ethyloxetan-3-yl)methyl]-1H-1,2,3-triazole-4-carboxylic acid is 211.22. |