2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide structure
|
Common Name | 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 1910716-83-4 | Molecular Weight | 319.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16BrClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16BrClN2O |
|---|---|
| Molecular Weight | 319.62 |
| InChIKey | HKIYPXLLANLGFX-UHFFFAOYSA-N |
| SMILES | CC(C)C(NCc1cc(Br)ccc1Cl)C(N)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide? |
| A: Molecular formula of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide is C12H16BrClN2O. |
| Q: What is the English name of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide? |
| A: The English name of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide is 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide. |
| Q: What is the molecular weight of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide? |
| A: Molecular weight of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide is 319.62. |
| Q: What is the CAS number of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide? |
| A: CAS number of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide is 1910716-83-4. |
| Q: What is the Chinese name of 1910716-83-4? |
| A: Chinese name of 1910716-83-4 is 1910716-83-4. |
| Q: What is the SMILES notation of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide? |
| A: SMILES notation of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide is CC(C)C(NCc1cc(Br)ccc1Cl)C(N)=O. |
| Q: What is the InChIKey of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide? |
| A: InChIKey of 2-{[(5-Bromo-2-chlorophenyl)methyl]amino}-3-methylbutanamide is HKIYPXLLANLGFX-UHFFFAOYSA-N. |