2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide
Modify Date: 2026-08-07 15:53:25
2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide structure
|
Common Name | 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1912443-55-0 | Molecular Weight | 354.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18N2O3S |
|---|---|
| Molecular Weight | 354.4 |
| InChIKey | NFWILHDNJCLWGZ-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)c1cccc(-c2ccc(C(N)=O)c3[nH]c(C)c(C)c23)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Enzyme Assay from US Patent US9920031: "Indole carboxamide compounds"
Source: BindingDB
Target: N/A
External Id: BindingDB_2711_1
|
|
Name: Enzyme Assay from US Patent US10604504: "Indole carboxamide compounds"
Source: BindingDB
Target: N/A
External Id: BindingDB_9073_1
|
|
Name: Enzyme Assay from US Patent US9802915: "Indole carboxamide compounds"
Source: BindingDB
Target: N/A
External Id: BindingDB_2079_1
|
|
Name: Biological Assay from US Patent US11623921: "Indole carboxamide compounds"
Source: BindingDB
Target: N/A
External Id: BindingDB_11202_1
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide? |
| A: InChIKey of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide is NFWILHDNJCLWGZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide? |
| A: Molecular weight of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide is 354.4. |
| Q: What is the molecular formula of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide? |
| A: Molecular formula of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide is C19H18N2O3S. |
| Q: What is the Chinese name of 1912443-55-0? |
| A: Chinese name of 1912443-55-0 is 1912443-55-0. |
| Q: What is the English name of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide? |
| A: The English name of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide is 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide. |
| Q: What is the CAS number of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide? |
| A: CAS number of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide is 1912443-55-0. |
| Q: What is the SMILES notation of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide? |
| A: SMILES notation of 2,3-dimethyl-4-(3-(vinylsulfonyl)phenyl)-1H-indole-7-carboxamide is C=CS(=O)(=O)c1cccc(-c2ccc(C(N)=O)c3[nH]c(C)c(C)c23)c1. |