2-Methyl-3-(2,4-dimethylphenyl)quinazolin-4(3H)-one structure
|
Common Name | 2-Methyl-3-(2,4-dimethylphenyl)quinazolin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 1915-80-6 | Molecular Weight | 264.32200 | |
| Density | 1.14g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 3-(2,4-dimethylphenyl)-2-methylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.32200 |
| Flash Point | 216.2ºC |
| Exact Mass | 264.12600 |
| PSA | 34.89000 |
| LogP | 3.31090 |
| Vapour Pressure | 9.95E-08mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | MPMDMUROZIYIIM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(C)nc3ccccc3c2=O)c(C)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ro 325 |
| 3-(2,4-dimethylphenyl)-2-methylquinazolin-4(3h)-one |
| 3-<2.4-Dimethyl-phenyl>-2-methyl-3H-chinazolin-4-on |
| 2-Methyl-3-(2,4-xylyl)-4(3H)-quinazolinone |
| 4(3H)-Quinazolinone,2-methyl-3-(2,4-xylyl) |
| 3-<2.4-Dimethyl-phenyl>-2-methyl-chinazolon-(4) |
| 2-Methyl-3-(2,4-dimethylphenyl)-4-quinazolone |
| QZH-2 |
| 3-(2,4-Xylyl)-2-methyl-3H-4-chinazolon |
| 2-Methyl-3-(2',4'-dimethylphenyl)-4-chinazolinon [German] |
| 3-(2,4-dimethyl-phenyl)-2-methyl-3H-quinazolin-4-one |
| B 192 |