1H-Indene-1-carboxylic acid, 2,3-dihydro-5,6-dimethoxy- structure
|
Common Name | 1H-Indene-1-carboxylic acid, 2,3-dihydro-5,6-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 19156-11-7 | Molecular Weight | 222.23700 | |
| Density | 1.243g/cm3 | Boiling Point | 385.7ºC at 760mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.2ºC | |
| Name | 5,6-Dimethoxy-1-indanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 385.7ºC at 760mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 150.2ºC |
| Exact Mass | 222.08900 |
| PSA | 55.76000 |
| LogP | 1.81820 |
| Vapour Pressure | 1.22E-06mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | SRMCSVPXTIJOBW-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(C(=O)O)CC2 |
| HS Code | 2918990090 |
|---|
|
~60%
1H-Indene-1-car... CAS#:19156-11-7 |
| Literature: Gan, Zongjie; Zhang, Di; Cao, Zhe; Xu, Yungen Journal of Chemical Research, 2011 , vol. 35, # 6 p. 317 - 319 |
|
~%
1H-Indene-1-car... CAS#:19156-11-7 |
| Literature: Gan, Zongjie; Zhang, Di; Cao, Zhe; Xu, Yungen Journal of Chemical Research, 2011 , vol. 35, # 6 p. 317 - 319 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| caleprunin B |
| 2-acetyl-5,6-dimethoxybenzofuran |
| 5,6-dimethoxyindan-1-carboxylic acid |
| 5,6-Dimethoxyindan-1-carbonsaeure |
| 5,6-dimethoxy-2-acetylbenzofuran |
| 1-Carboxy-5,6-dimethoxy-indan |