Butanenitrile,4-(3-nitrophenoxy)- structure
|
Common Name | Butanenitrile,4-(3-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 19157-86-9 | Molecular Weight | 206.19800 | |
| Density | 1.226g/cm3 | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8ºC | |
| Name | 4-(3-nitrophenoxy)butanenitrile |
|---|
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 388.6ºC at 760 mmHg |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Flash Point | 188.8ºC |
| Exact Mass | 206.06900 |
| PSA | 78.84000 |
| LogP | 2.80058 |
| Vapour Pressure | 3.02E-06mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | QYCTZXYWWRYKRO-UHFFFAOYSA-N |
| SMILES | N#CCCCOc1cccc([N+](=O)[O-])c1 |
|
~%
Butanenitrile,4... CAS#:19157-86-9 |
| Literature: Baker; Lourens Journal of medicinal chemistry, 1968 , vol. 11, # 1 p. 26 - 33 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |