diethyl 2-hept-1-ynyl-2-prop-1-enylpropanedioate structure
|
Common Name | diethyl 2-hept-1-ynyl-2-prop-1-enylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 191801-57-7 | Molecular Weight | 294.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-hept-1-ynyl-2-prop-1-enylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O4 |
|---|---|
| Molecular Weight | 294.38600 |
| Exact Mass | 294.18300 |
| PSA | 52.60000 |
| LogP | 3.25880 |
| InChIKey | HHAUGXSOYMMCQD-UHFFFAOYSA-N |
| SMILES | CC=CC(C#CCCCCC)(C(=O)OCC)C(=O)OCC |
|
~%
diethyl 2-hept-... CAS#:191801-57-7 |
| Literature: Morimoto, Tsumoru; Fuji, Koji; Tsutsumi, Ken; Kakiuchi, Kiyomi Journal of the American Chemical Society, 2002 , vol. 124, # 15 p. 3806 - 3807 |
| Propanedioic acid,2-heptynyl-2-propenyl-,diethyl ester |