PERFLUORO(2-METHYL-3-OXAHEPTANEDIOYL)FLUORIDE structure
|
Common Name | PERFLUORO(2-METHYL-3-OXAHEPTANEDIOYL)FLUORIDE | ||
|---|---|---|---|---|
| CAS Number | 19190-57-9 | Molecular Weight | 360.05400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4-hexafluoro-4-(1,1,1,2,3-pentafluoro-3-oxopropan-2-yl)oxybutanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7F12O3 |
|---|---|
| Molecular Weight | 360.05400 |
| Exact Mass | 359.96600 |
| PSA | 43.37000 |
| LogP | 3.08670 |
| InChIKey | MNEZTIJYMZUPMM-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(=O)F)C(F)(F)F |
| HS Code | 2918990090 |
|---|
|
~%
PERFLUORO(2-MET... CAS#:19190-57-9 |
| Literature: Rapkin, A. I.; Zabolot-skikh, V. F.; Kochanov, A. S.; Tiunov, A. V.; Zhirnov, O. M. Russian Journal of Applied Chemistry, 1995 , vol. 68, # 1part2 p. 133 - 134 Zhurnal Prikladnoi Khimii (Sankt-Peterburg, Russian Federation), 1995 , vol. 68, # 1 p. 151 - 152 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| PC6433 |
| 1,5-Bis(fluorocarbonyl)perfluoro(1-methyl-2-oxapentane) |
| Butanoyl fluoride,2,2,3,3,4,4-hexafluoro-4-[1,2,2,2-tetrafluoro-1-(fluorocarbonyl)ethoxy] |
| Perfluoro(2-methyl-3-oxaheptanedioyl)fluoride |
| 2,2,3,3,4,4-hexafluoro-4-[(1,1,1,2,3-pentafluoro-3-oxopropan-2-yl)oxy]butanoyl fluoride |
| Perfluoro-2-methyl-3-oxaheptandioylfluorid |