sodium acetyl sulphate
Modify Date: 2025-10-02 15:49:43
sodium acetyl sulphate structure
|
Common Name | sodium acetyl sulphate | ||
|---|---|---|---|---|
| CAS Number | 19201-24-2 | Molecular Weight | 162.09700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2H3NaO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,acetyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C2H3NaO5S |
|---|---|
| Molecular Weight | 162.09700 |
| Exact Mass | 161.96000 |
| PSA | 91.88000 |
| LogP | 0.09050 |
| InChIKey | VCLVUNFJTOOMIR-UHFFFAOYSA-M |
| SMILES | CC(=O)OS(=O)(=O)[O-].[Na+] |
| SODIUM SULFONATOOXYCARBONYLMETHANE |
| Aceticacid,anhydride with NaHSO4 (6CI) |
| Sodium acetyl sulphate |
| Acetic acid,monoanhydride with sulfuric acid,sodium salt (8CI,9CI) |
| Sodium acetyl sulfate |
| EINECS 242-873-2 |