methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate
Modify Date: 2026-07-03 13:42:54
![methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/456/1920238-86-3.png)
methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate structure
|
Common Name | methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1920238-86-3 | Molecular Weight | 264.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N4O4 |
|---|---|
| Molecular Weight | 264.24 |
| InChIKey | BYFAWZFPCBISDU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cn(CC(=O)NCc2ccco2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: CAS number of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate is 1920238-86-3. |
| Q: What is the InChIKey of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: InChIKey of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate is BYFAWZFPCBISDU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: SMILES notation of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate is COC(=O)c1cn(CC(=O)NCc2ccco2)nn1. |
| Q: What is the molecular formula of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular formula of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate is C11H12N4O4. |
| Q: What is the molecular weight of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular weight of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate is 264.24. |
| Q: What is the English name of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: The English name of methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate is methyl 1-({[(furan-2-yl)methyl]carbamoyl}methyl)-1H-1,2,3-triazole-4-carboxylate. |
| Q: What is the Chinese name of 1920238-86-3? |
| A: Chinese name of 1920238-86-3 is 1920238-86-3. |