2,6,6-trimethylcyclohexene-1-carbonitrile oxide structure
|
Common Name | 2,6,6-trimethylcyclohexene-1-carbonitrile oxide | ||
|---|---|---|---|---|
| CAS Number | 19203-43-1 | Molecular Weight | 165.23200 | |
| Density | 0.97g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6,6-trimethylcyclohexene-1-carbonitrile oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23200 |
| Exact Mass | 165.11500 |
| PSA | 30.67000 |
| LogP | 3.07008 |
| Index of Refraction | 1.5 |
| InChIKey | ORVCRUQGTRRJOB-UHFFFAOYSA-N |
| SMILES | CC1=C(C#[N+][O-])C(C)(C)CCC1 |
|
~%
2,6,6-trimethyl... CAS#:19203-43-1 |
| Literature: Grundmann,C.; Datta,S.K. Journal of Organic Chemistry, 1969 , vol. 34, # 6 p. 2016 - 2018 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,6,6-trimethyl-cyclohex-1-enecarbonitrile N-oxide |