tert-butyl 5-(Methoxy(Methyl)amino)-5-oxopentanoate structure
|
Common Name | tert-butyl 5-(Methoxy(Methyl)amino)-5-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 192123-40-3 | Molecular Weight | 231.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 5-[methoxy(methyl)amino]-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H21NO4 |
|---|---|
| Molecular Weight | 231.28900 |
| Exact Mass | 231.14700 |
| PSA | 55.84000 |
| LogP | 1.51820 |
| InChIKey | AHBXDGDLFNAYOZ-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)CCCC(=O)OC(C)(C)C |
|
~93%
tert-butyl 5-(M... CAS#:192123-40-3 |
| Literature: WISCONSIN ALUMNI RESEARCH FOUNDATION Patent: WO2007/112358 A1, 2007 ; Location in patent: Page/Page column 51-52 ; |
|
~%
tert-butyl 5-(M... CAS#:192123-40-3 |
| Literature: Bitan, Gal; Muller, Dan; Kasher, Ron; Gluhov, Evgenia V.; Gilon, Chaim Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 10 p. 1501 - 1510 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| tert-butyl 5-(methoxy(methyl)amino)-5-oxopentanoate |
| I14-5444 |