mycothiol S-conjugates structure
|
Common Name | mycothiol S-conjugates | ||
|---|---|---|---|---|
| CAS Number | 192126-76-4 | Molecular Weight | 486.49100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30N2O12S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of mycothiol S-conjugatesMycothiol is a major low molecular-mass thiol that exists in mycobacteria. Mycothiol is an intracellular reducing agent[1]. |
| Name | (2R)-2-acetamido-N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyoxan-3-yl]-3-sulfanylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Mycothiol is a major low molecular-mass thiol that exists in mycobacteria. Mycothiol is an intracellular reducing agent[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Nilewar SS, et al. Mycothiol: a promising antitubercular target. Bioorg Chem. 2014 Feb;52:62-8. |
| Molecular Formula | C17H30N2O12S |
|---|---|
| Molecular Weight | 486.49100 |
| Exact Mass | 486.15200 |
| PSA | 284.28000 |
| InChIKey | MQBCDKMPXVYCGO-MGQAWMCHSA-N |
| SMILES | CC(=O)NC(CS)C(=O)NC1C(OC2C(O)C(O)C(O)C(O)C2O)OC(CO)C(O)C1O |
| AcCys-GlcN-Ins |
| 1D-myo-inosityl 2-(N-acetylcysteinyl)amido-2-deoxy-1-D-glucopyranoside |
| mycothiol |
| MSH |
| mycothiol S-conjugates |
| CPD1G-2 |
| U17 cysteine |