Benzene,[bromo[(phenylmethyl)sulfonyl]methyl] structure
|
Common Name | Benzene,[bromo[(phenylmethyl)sulfonyl]methyl] | ||
|---|---|---|---|---|
| CAS Number | 19217-59-5 | Molecular Weight | 325.22100 | |
| Density | 1.492g/cm3 | Boiling Point | 475.1ºC at 760mmHg | |
| Molecular Formula | C14H13BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.1ºC | |
| Name | Benzylzinc bromide 0.5 M in Tetrahydrofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 475.1ºC at 760mmHg |
| Molecular Formula | C14H13BrO2S |
| Molecular Weight | 325.22100 |
| Flash Point | 241.1ºC |
| Exact Mass | 323.98200 |
| PSA | 42.52000 |
| LogP | 4.77590 |
| Vapour Pressure | 9.81E-09mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | WSAVKRNOQDMKLH-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)C(Br)c1ccccc1 |
|
~%
Benzene,[bromo[... CAS#:19217-59-5 |
| Literature: Cinquini,M.; Colonna,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1883 - 1886 |
|
~%
Benzene,[bromo[... CAS#:19217-59-5 |
| Literature: Cinquini,M.; Colonna,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1883 - 1886 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| benzylic zinc bromide |
| benzyl zinc bromide |
| Benzylzinc bromide solution |