Benzene,[bromo[(phenylmethyl)sulfonyl]methyl]
![Benzene,[bromo[(phenylmethyl)sulfonyl]methyl] Structure](https://image.chemsrc.com/caspic/401/19217-59-5.png)
Benzene,[bromo[(phenylmethyl)sulfonyl]methyl] structure
|
Common Name | Benzene,[bromo[(phenylmethyl)sulfonyl]methyl] | ||
|---|---|---|---|---|
| CAS Number | 19217-59-5 | Molecular Weight | 325.22100 | |
| Density | 1.492g/cm3 | Boiling Point | 475.1ºC at 760mmHg | |
| Molecular Formula | C14H13BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzylzinc bromide 0.5 M in Tetrahydrofuran |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 475.1ºC at 760mmHg |
| Molecular Formula | C14H13BrO2S |
| Molecular Weight | 325.22100 |
| Flash Point | 241.1ºC |
| Exact Mass | 323.98200 |
| PSA | 42.52000 |
| LogP | 4.77590 |
| Vapour Pressure | 9.81E-09mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | WSAVKRNOQDMKLH-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)C(Br)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzene,[bromo[... CAS#:19217-59-5 |
| Literature: Cinquini,M.; Colonna,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1883 - 1886 |
|
~%
Benzene,[bromo[... CAS#:19217-59-5 |
| Literature: Cinquini,M.; Colonna,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1883 - 1886 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzylic zinc bromide |
| benzyl zinc bromide |
| Benzylzinc bromide solution |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: Molecular weight of Benzylzinc bromide 0.5 M in Tetrahydrofuran is 325.22100. |
| Q: What is the polar surface area (PSA) of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: Polar surface area (PSA) of Benzylzinc bromide 0.5 M in Tetrahydrofuran is 42.52000. |
| Q: What is the English name of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: The English name of Benzylzinc bromide 0.5 M in Tetrahydrofuran is Benzylzinc bromide 0.5 M in Tetrahydrofuran. |
| Q: What is the InChIKey of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: InChIKey of Benzylzinc bromide 0.5 M in Tetrahydrofuran is WSAVKRNOQDMKLH-UHFFFAOYSA-N. |
| Q: What is the boiling point of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: Boiling point of Benzylzinc bromide 0.5 M in Tetrahydrofuran is 475.1ºC at 760mmHg. |
| Q: What are the upstream materials of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: Related upstream materials(CAS) of Benzylzinc bromide 0.5 M in Tetrahydrofuran: 26910-38-3;621-08-9. |
| Q: What is the CAS number of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: CAS number of Benzylzinc bromide 0.5 M in Tetrahydrofuran is 19217-59-5. |
| Q: What is the Chinese name of 19217-59-5? |
| A: Chinese name of 19217-59-5 is 19217-59-5. |
| Q: What is the SMILES notation of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: SMILES notation of Benzylzinc bromide 0.5 M in Tetrahydrofuran is O=S(=O)(Cc1ccccc1)C(Br)c1ccccc1. |
| Q: What is the molecular formula of Benzylzinc bromide 0.5 M in Tetrahydrofuran? |
| A: Molecular formula of Benzylzinc bromide 0.5 M in Tetrahydrofuran is C14H13BrO2S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |