(4-methoxyphenyl) N-phenylcarbamate structure
|
Common Name | (4-methoxyphenyl) N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 19219-48-8 | Molecular Weight | 243.25800 | |
| Density | 1.226g/cm3 | Boiling Point | 359.6ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | (4-methoxyphenyl) N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 359.6ºC at 760 mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 171.3ºC |
| Exact Mass | 243.09000 |
| PSA | 51.05000 |
| LogP | 3.31970 |
| Vapour Pressure | 2.34E-05mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | OKZNBJVONJHCEP-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(=O)Nc2ccccc2)cc1 |
|
~%
(4-methoxypheny... CAS#:19219-48-8 |
| Literature: Yew, Kyoung Han; Koh, Han Joong; Lee, Hai Whang; Lee, Ikchoon Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1995 , # 12 p. 2263 - 2268 |
| 4-Methoxyphenyl-N-phenylcarbamat |
| p-methoxyphenyl anilinoformate |
| N-Phenyl-carbaminsaeure-<4-methoxy-phenylester> |
| p-Methoxy-phenyl-N-phenyl-carbamat |
| Phenyl-carbamidsaeure-(4-methoxy-phenylester) |
| 1-Methoxy-4-phenylcarbamoyloxy-benzol |
| phenyl-carbamic acid-(4-methoxy-phenyl ester) |
| 4-methoxyphenyl phenylcarbamate |