1,2,3-trichloro-4,5,6-trimethylbenzene structure
|
Common Name | 1,2,3-trichloro-4,5,6-trimethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 19219-81-9 | Molecular Weight | 223.52700 | |
| Density | 1.283g/cm3 | Boiling Point | 302.7ºC at 760mmHg | |
| Molecular Formula | C9H9Cl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | 1,2,3-trichloro-4,5,6-trimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 302.7ºC at 760mmHg |
| Molecular Formula | C9H9Cl3 |
| Molecular Weight | 223.52700 |
| Flash Point | 203.9ºC |
| Exact Mass | 221.97700 |
| LogP | 4.57200 |
| Vapour Pressure | 0.00175mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | QCTIBRJBUAXXEB-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(Cl)c(Cl)c(Cl)c1C |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,5,6-Trichlor-1,2,3-trimethyl-benzol |
| Benzene,1,2,3-trichloro-4,5,6-trimethyl |
| Trichlorohemimellitene |
| 4,5,6-Trichloro-1,2,3-trimethylbenzene |
| 1,2,3-trichloro-4,5,6-trimethyl-benzene |
| Trichloro-1,2,3-trimethyl-benzol |
| 1,2,3-Trichlor-4,5,6-trimethyl-benzol |
| 1,2,3-Trichlor-trimethylbenzol |
| 1,2,3-Trichlorotrimethylbenzene |