N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide
Modify Date: 2026-07-03 19:17:21
![N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide Structure](https://www.chemsrc.com/extcaspic/010/1922099-44-2.png)
N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide structure
|
Common Name | N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 1922099-44-2 | Molecular Weight | 455.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20ClF2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H20ClF2N3O2 |
|---|---|
| Molecular Weight | 455.9 |
| InChIKey | SEGVMNFLEDIAEE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CN(C(=O)c2cccc(-c3ccccn3)c2)CC(F)(F)C1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of Rho/MRTF/SRF pathway in human primary dermal fibroblasts assessed as in...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4010977
|
|
Name: Thermodynamic aqueous solubility of the compound in water by nitrogen detection metho...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4010975
|
|
Name: Half life in CD-1 mouse liver microsomes at 1 uM in presence of NADPH by LC-MS/MS ana...
Source: ChEMBL
Target: Liver
External Id: CHEMBL4010974
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide? |
| A: SMILES notation of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide is O=C(Nc1ccc(Cl)cc1)C1CN(C(=O)c2cccc(-c3ccccn3)c2)CC(F)(F)C1. |
| Q: What is the English name of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide? |
| A: The English name of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide is N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide. |
| Q: What is the InChIKey of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide? |
| A: InChIKey of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide is SEGVMNFLEDIAEE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide? |
| A: Molecular weight of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide is 455.9. |
| Q: What is the Chinese name of 1922099-44-2? |
| A: Chinese name of 1922099-44-2 is 1922099-44-2. |
| Q: What is the molecular formula of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide? |
| A: Molecular formula of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide is C24H20ClF2N3O2. |
| Q: What is the CAS number of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide? |
| A: CAS number of N-(4-Chlorophenyl)-5,5-difluoro-1-[3-(2-pyridinyl)benzoyl]-3-piperidinecarboxamide is 1922099-44-2. |