5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole
Modify Date: 2025-09-10 17:52:20
5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole structure
|
Common Name | 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole | ||
|---|---|---|---|---|
| CAS Number | 19221-86-4 | Molecular Weight | 267.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO |
|---|---|
| Molecular Weight | 267.4 |
| InChIKey | BFXLDESMGMFRFG-UHFFFAOYSA-N |
| SMILES | CC1=C(c2cc(-c3ccccc3)on2)C(C)(C)CCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole? |
| A: InChIKey of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole is BFXLDESMGMFRFG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole? |
| A: CAS number of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole is 19221-86-4. |
| Q: What is the Chinese name of 19221-86-4? |
| A: Chinese name of 19221-86-4 is 19221-86-4. |
| Q: What is the molecular weight of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole? |
| A: Molecular weight of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole is 267.4. |
| Q: What is the SMILES notation of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole? |
| A: SMILES notation of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole is CC1=C(c2cc(-c3ccccc3)on2)C(C)(C)CCC1. |
| Q: What is the molecular formula of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole? |
| A: Molecular formula of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole is C18H21NO. |
| Q: What is the English name of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole? |
| A: The English name of 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole is 5-Phenyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)isoxazole. |