(S)-1-Cbz-pyrrolidine-3-carboxylic acid structure
|
Common Name | (S)-1-Cbz-pyrrolidine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 192214-00-9 | Molecular Weight | 249.26200 | |
| Density | 1.309g/cm3 | Boiling Point | 432.3ºC at 760mmHg | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | (3S)-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760mmHg |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26200 |
| Flash Point | 215.3ºC |
| Exact Mass | 249.10000 |
| PSA | 66.84000 |
| LogP | 1.66760 |
| Vapour Pressure | 3.06E-08mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | JSASVUTVTRNJHA-NSHDSACASA-N |
| SMILES | O=C(O)C1CCN(C(=O)OCc2ccccc2)C1 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-1-((Benzyloxy)carbonyl)pyrrolidine-3-carboxylic acid |
| S-1-CBZ-Pyrrolidine-3-carboxylic acid |