2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate structure
|
Common Name | 2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 19224-29-4 | Molecular Weight | 400.46500 | |
| Density | 1.122g/cm3 | Boiling Point | 496.7ºC at 760mmHg | |
| Molecular Formula | C23H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | 2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 496.7ºC at 760mmHg |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.46500 |
| Flash Point | 213.1ºC |
| Exact Mass | 400.18900 |
| PSA | 71.06000 |
| LogP | 3.89630 |
| Vapour Pressure | 5.29E-10mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | HBDPNIKSHRQAJF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCOc1ccc(C(C)(C)c2ccc(OCCOC(C)=O)cc2)cc1 |
|
~%
2-[4-[2-[4-(2-a... CAS#:19224-29-4 |
| Literature: Riande, Evaristo; Jimeno, Maria L.; Salvador, Rosa; Abajo, Javier de; Guzman, Julio Journal of Physical Chemistry, 1990 , vol. 94, # 19 p. 7435 - 7439 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dianol 22 diacetate |
| Ethanol,2,2'-((1-methylethylidene)bis(4,1-phenyleneoxy))bis-,diacetate |
| propane-2,2-diylbis(benzene-4,1-diyloxyethane-2,1-diyl) diacetate |
| 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bisethyl diacetate |
| EINECS 242-895-2 |
| dyanol 22 diacetate |