1-(4-PHENOXYPHENYL)-1H-IMIDAZOLE structure
|
Common Name | 1-(4-PHENOXYPHENYL)-1H-IMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 192330-66-8 | Molecular Weight | 236.26900 | |
| Density | 1.12g/cm3 | Boiling Point | 387.9ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4ºC | |
| Name | 1-(4-phenoxyphenyl)imidazole |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 387.9ºC at 760 mmHg |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.26900 |
| Flash Point | 188.4ºC |
| Exact Mass | 236.09500 |
| PSA | 27.05000 |
| LogP | 3.66460 |
| Vapour Pressure | 7.12E-06mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | JMZBMARJCNCGAN-UHFFFAOYSA-N |
| SMILES | c1ccc(Oc2ccc(-n3ccnc3)cc2)cc1 |
| HS Code | 2933290090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |