benzoyl glucuronide
benzoyl glucuronide structure
|
Common Name | benzoyl glucuronide | ||
|---|---|---|---|---|
| CAS Number | 19237-53-7 | Molecular Weight | 298.24500 | |
| Density | 1.6g/cm3 | Boiling Point | 563.7ºC at 760mmHg | |
| Molecular Formula | C13H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
Summary: (2S,3S,4S,5R,6S)-6-Benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid, also known as benzoyl glucuronide, CAS number 19237-53-7, molecular formula C13H14O8, molecular weight 298.24500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 563.7ºC at 760mmHg |
| Molecular Formula | C13H14O8 |
| Molecular Weight | 298.24500 |
| Flash Point | 216.9ºC |
| Exact Mass | 298.06900 |
| PSA | 133.52000 |
| Vapour Pressure | 1.52E-13mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | NLOPFVNXNMEEDI-UNLLLRGISA-N |
| SMILES | O=C(OC1OC(C(=O)O)C(O)C(O)C1O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~88%
benzoyl glucuronide CAS#:19237-53-7
Learn More
|
| Literature: Baba, Akiko; Yoshioka, Tadao Journal of Organic Chemistry, 2007 , vol. 72, # 25 p. 9541 - 9549 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoyl glucuronide (Benzoic acid) |
| Benzoic acid glucuronide |
| |A-d-glucopyranuronic acid,1-benzoate |
| Benzoyl glucuronide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: Molecular weight of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is 298.24500. |
| Q: What is the InChIKey of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: InChIKey of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is NLOPFVNXNMEEDI-UNLLLRGISA-N. |
| Q: What is the Chinese name of 19237-53-7? |
| A: Chinese name of 19237-53-7 is 19237-53-7. |
| Q: What is the CAS number of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: CAS number of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is 19237-53-7. |
| Q: What is the boiling point of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: Boiling point of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is 563.7ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: Polar surface area (PSA) of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is 133.52000. |
| Q: What is the molecular formula of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: Molecular formula of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is C13H14O8. |
| Q: What is the English name of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: The English name of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid. |
| Q: What is the SMILES notation of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid? |
| A: SMILES notation of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid is O=C(OC1OC(C(=O)O)C(O)C(O)C1O)c1ccccc1. |
| Q: What English synonyms does (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid have? |
| A: English synonyms of (2S,3S,4S,5R,6S)-6-benzoyloxy-3,4,5-trihydroxyoxane-2-carboxylic acid: Benzoyl glucuronide (Benzoic acid), Benzoic acid glucuronide, |A-d-glucopyranuronic acid,1-benzoate, Benzoyl glucuronide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |