3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]
Modify Date: 2025-09-04 13:42:01
![3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] Structure](https://www.chemsrc.com/extcaspic/199/19237-92-4.png)
3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] structure
|
Common Name | 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] | ||
|---|---|---|---|---|
| CAS Number | 19237-92-4 | Molecular Weight | 248.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H4N2O6 |
|---|---|
| Molecular Weight | 248.15 |
| InChIKey | OXLDGWBBTWKAIS-UHFFFAOYSA-N |
| SMILES | O=c1onc(-c2cccc(-c3noc(=O)o3)c2)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]? |
| A: Molecular formula of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] is C10H4N2O6. |
| Q: What is the CAS number of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]? |
| A: CAS number of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] is 19237-92-4. |
| Q: What is the Chinese name of 19237-92-4? |
| A: Chinese name of 19237-92-4 is 19237-92-4. |
| Q: What is the molecular weight of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]? |
| A: Molecular weight of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] is 248.15. |
| Q: What is the SMILES notation of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]? |
| A: SMILES notation of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] is O=c1onc(-c2cccc(-c3noc(=O)o3)c2)o1. |
| Q: What is the English name of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]? |
| A: The English name of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] is 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]. |
| Q: What is the InChIKey of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one]? |
| A: InChIKey of 3,3'-(1,3-Phenylene)bis[1,4,2-dioxazol-5-one] is OXLDGWBBTWKAIS-UHFFFAOYSA-N. |